C21H26ClN3O2 — CID 172665115
(3aR,5R,6R,7aS)-2-(6-chloroquinolin-4-yl)-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172665115) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-(6-chloroquinolin-4-yl)-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-(6-chloroquinolin-4-yl)-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172665115 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-(6-chloroquinolin-4-yl)-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@@H]1C[C@H]2CN(c3ccnc4ccc(Cl)cc34)C[C@H]2C[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C21H26ClN3O2/c22-16-1-2-18-17(11-16)19(3-4-23-18)25-12-14-9-20(21(26)10-15(14)13-25)24-5-7-27-8-6-24/h1-4,11,14-15,20-21,26H,5-10,12-13H2/t14-,15+,20-,21-/m1/s1 |
| InChIKey | GAPMVCOZTLGKJA-IALDWUNLSA-N |
| XLogP | 2.80 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |