C19H18ClN3O — CID 155909727
(3S,4R)-1-(6-chloroquinolin-4-yl)-4-(pyridin-4-ylmethyl)pyrrolidin-3-ol (PubChem CID 155909727) has the molecular formula C19H18ClN3O and a molecular weight of 339.83 g/mol. Its IUPAC name is (3S,4R)-1-(6-chloroquinolin-4-yl)-4-(pyridin-4-ylmethyl)pyrrolidin-3-ol.
| Compound Name | (3S,4R)-1-(6-chloroquinolin-4-yl)-4-(pyridin-4-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 155909727 |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (3S,4R)-1-(6-chloroquinolin-4-yl)-4-(pyridin-4-ylmethyl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CN(c2ccnc3ccc(Cl)cc23)C[C@H]1Cc1ccncc1 |
| InChI | InChI=1S/C19H18ClN3O/c20-15-1-2-17-16(10-15)18(5-8-22-17)23-11-14(19(24)12-23)9-13-3-6-21-7-4-13/h1-8,10,14,19,24H,9,11-12H2/t14-,19-/m1/s1 |
| InChIKey | JMIIOQFCMCYQIM-AUUYWEPGSA-N |
| XLogP | 3.32 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |