C19H24N4O3S — CID 172659521
N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-thiophen-3-ylacetyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methylimidazole-4-carboxamide (PubChem CID 172659521) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-thiophen-3-ylacetyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-thiophen-3-ylacetyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 172659521 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-thiophen-3-ylacetyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cncc1C(=O)N[C@H]1C[C@H]2CN(C(=O)Cc3ccsc3)C[C@H]2C[C@@H]1O |
| InChI | InChI=1S/C19H24N4O3S/c1-22-11-20-7-16(22)19(26)21-15-5-13-8-23(9-14(13)6-17(15)24)18(25)4-12-2-3-27-10-12/h2-3,7,10-11,13-15,17,24H,4-6,8-9H2,1H3,(H,21,26)/t13-,14+,15-,17-/m0/s1 |
| InChIKey | AWDGRHPVTFJZAA-IVSAIRAKSA-N |
| XLogP | 1.05 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |