C18H24N4O4 — CID 175641066
[(3aR,5R,6R,7aS)-5-methoxy-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(furan-3-yl)methanone (PubChem CID 175641066) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-methoxy-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(furan-3-yl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-methoxy-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 175641066 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-methoxy-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(furan-3-yl)methanone |
| SMILES | COCc1cn([C@@H]2C[C@@H]3CN(C(=O)c4ccoc4)C[C@@H]3C[C@H]2OC)nn1 |
| InChI | InChI=1S/C18H24N4O4/c1-24-11-15-9-22(20-19-15)16-5-13-7-21(8-14(13)6-17(16)25-2)18(23)12-3-4-26-10-12/h3-4,9-10,13-14,16-17H,5-8,11H2,1-2H3/t13-,14+,16-,17-/m1/s1 |
| InChIKey | IZWIJVLFEDSCOL-YALNPMBYSA-N |
| XLogP | 1.76 |
| TPSA | 82.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |