C21H23N5O2S — CID 175646200
[(3aR,5R,6R,7aS)-5-methoxy-6-(4-pyridin-2-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-thiophen-3-ylmethanone (PubChem CID 175646200) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-methoxy-6-(4-pyridin-2-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-methoxy-6-(4-pyridin-2-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 175646200 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-methoxy-6-(4-pyridin-2-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-thiophen-3-ylmethanone |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)c3ccsc3)C[C@H]2C[C@H]1n1cc(-c2ccccn2)nn1 |
| InChI | InChI=1S/C21H23N5O2S/c1-28-20-9-16-11-25(21(27)14-5-7-29-13-14)10-15(16)8-19(20)26-12-18(23-24-26)17-4-2-3-6-22-17/h2-7,12-13,15-16,19-20H,8-11H2,1H3/t15-,16+,19-,20-/m1/s1 |
| InChIKey | TVIBYGKNQKFGGW-WOUAJJJCSA-N |
| XLogP | 3.14 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |