C24H28N6O2 — CID 176500108
6-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-phenyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-methylpyridine-3-carboxamide (PubChem CID 176500108) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 6-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-phenyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-phenyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 176500108 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 6-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-phenyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(N2C[C@H]3C[C@@H](n4cc(-c5ccccc5)nn4)[C@H](OC)C[C@H]3C2)nc1 |
| InChI | InChI=1S/C24H28N6O2/c1-25-24(31)17-8-9-23(26-12-17)29-13-18-10-21(22(32-2)11-19(18)14-29)30-15-20(27-28-30)16-6-4-3-5-7-16/h3-9,12,15,18-19,21-22H,10-11,13-14H2,1-2H3,(H,25,31)/t18-,19+,21-,22-/m1/s1 |
| InChIKey | UMYWDZBJSASORL-NPDDRXJXSA-N |
| XLogP | 2.80 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |