C23H24N6O2 — CID 176504481
4-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-pyridin-4-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]furo[3,2-c]pyridine (PubChem CID 176504481) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 4-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-pyridin-4-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]furo[3,2-c]pyridine.
| Compound Name | 4-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-pyridin-4-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 176504481 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 4-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-pyridin-4-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]furo[3,2-c]pyridine |
| SMILES | CO[C@@H]1C[C@H]2CN(c3nccc4occc34)C[C@H]2C[C@H]1n1cc(-c2ccncc2)nn1 |
| InChI | InChI=1S/C23H24N6O2/c1-30-22-11-17-13-28(23-18-5-9-31-21(18)4-8-25-23)12-16(17)10-20(22)29-14-19(26-27-29)15-2-6-24-7-3-15/h2-9,14,16-17,20,22H,10-13H2,1H3/t16-,17+,20-,22-/m1/s1 |
| InChIKey | ZOPBBPXDEIYMCR-IMLKGASGSA-N |
| XLogP | 3.58 |
| TPSA | 82.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |