C24H30N6O2 — CID 176505202
1-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-phenyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(2-methylpyrazol-3-yl)propan-1-one (PubChem CID 176505202) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-phenyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(2-methylpyrazol-3-yl)propan-1-one.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-phenyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(2-methylpyrazol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 176505202 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-methoxy-6-(4-phenyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(2-methylpyrazol-3-yl)propan-1-one |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)CCc3ccnn3C)C[C@H]2C[C@H]1n1cc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C24H30N6O2/c1-28-20(10-11-25-28)8-9-24(31)29-14-18-12-22(23(32-2)13-19(18)15-29)30-16-21(26-27-30)17-6-4-3-5-7-17/h3-7,10-11,16,18-19,22-23H,8-9,12-15H2,1-2H3/t18-,19+,22-,23-/m1/s1 |
| InChIKey | NFSGQUOOAAYRKA-IYRWYFENSA-N |
| XLogP | 2.74 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |