C23H28N6O3 — CID 176504581
[(3aR,5R,6R,7aS)-5-methoxy-6-[4-(2-methoxyphenyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methyl-1H-pyrazol-5-yl)methanone (PubChem CID 176504581) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-methoxy-6-[4-(2-methoxyphenyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methyl-1H-pyrazol-5-yl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-methoxy-6-[4-(2-methoxyphenyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methyl-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 176504581 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-methoxy-6-[4-(2-methoxyphenyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methyl-1H-pyrazol-5-yl)methanone |
| SMILES | COc1ccccc1-c1cn([C@@H]2C[C@@H]3CN(C(=O)c4[nH]ncc4C)C[C@@H]3C[C@H]2OC)nn1 |
| InChI | InChI=1S/C23H28N6O3/c1-14-10-24-26-22(14)23(30)28-11-15-8-19(21(32-3)9-16(15)12-28)29-13-18(25-27-29)17-6-4-5-7-20(17)31-2/h4-7,10,13,15-16,19,21H,8-9,11-12H2,1-3H3,(H,24,26)/t15-,16+,19-,21-/m1/s1 |
| InChIKey | HGKGDQVFIXYFCV-NNNWTRQLSA-N |
| XLogP | 2.72 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |