C21H30N4O4 — CID 176502302
[(3aS,5R,6R,7aR)-5-[4-(2-hydroxypropan-2-yl)triazol-1-yl]-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,5-dimethylfuran-3-yl)methanone (PubChem CID 176502302) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-[4-(2-hydroxypropan-2-yl)triazol-1-yl]-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,5-dimethylfuran-3-yl)methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-[4-(2-hydroxypropan-2-yl)triazol-1-yl]-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,5-dimethylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 176502302 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-[4-(2-hydroxypropan-2-yl)triazol-1-yl]-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,5-dimethylfuran-3-yl)methanone |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)c3cc(C)oc3C)C[C@H]2C[C@H]1n1cc(C(C)(C)O)nn1 |
| InChI | InChI=1S/C21H30N4O4/c1-12-6-16(13(2)29-12)20(26)24-9-14-7-17(18(28-5)8-15(14)10-24)25-11-19(22-23-25)21(3,4)27/h6,11,14-15,17-18,27H,7-10H2,1-5H3/t14-,15+,17-,18-/m1/s1 |
| InChIKey | JTKWQXONEGCENL-CYGHRXIMSA-N |
| XLogP | 2.45 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |