C25H40N4O2 — CID 176501896
[(3aS,5R,6R,7aR)-5-(4-tert-butyltriazol-1-yl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylcyclopentyl)methanone (PubChem CID 176501896) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(4-tert-butyltriazol-1-yl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylcyclopentyl)methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(4-tert-butyltriazol-1-yl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylcyclopentyl)methanone |
|---|---|
| PubChem CID | 176501896 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(4-tert-butyltriazol-1-yl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylcyclopentyl)methanone |
| SMILES | CC1(C(=O)N2C[C@H]3C[C@@H](n4cc(C(C)(C)C)nn4)[C@H](OCC4CC4)C[C@H]3C2)CCCC1 |
| InChI | InChI=1S/C25H40N4O2/c1-24(2,3)22-15-29(27-26-22)20-11-18-13-28(23(30)25(4)9-5-6-10-25)14-19(18)12-21(20)31-16-17-7-8-17/h15,17-21H,5-14,16H2,1-4H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | YZWQNUWNMLMMAT-PLACYPQZSA-N |
| XLogP | 4.36 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |