C20H31N7O2 — CID 176505884
(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-2-(2-ethyl-1,2,4-triazol-3-yl)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 176505884) has the molecular formula C20H31N7O2 and a molecular weight of 401.52 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-2-(2-ethyl-1,2,4-triazol-3-yl)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-2-(2-ethyl-1,2,4-triazol-3-yl)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 176505884 |
| Molecular Formula | C20H31N7O2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | (3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-2-(2-ethyl-1,2,4-triazol-3-yl)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CCn1ncnc1N1C[C@H]2C[C@@H](n3cc(COC)nn3)[C@H](OCC3CC3)C[C@H]2C1 |
| InChI | InChI=1S/C20H31N7O2/c1-3-26-20(21-13-22-26)25-8-15-6-18(27-10-17(12-28-2)23-24-27)19(7-16(15)9-25)29-11-14-4-5-14/h10,13-16,18-19H,3-9,11-12H2,1-2H3/t15-,16+,18-,19-/m1/s1 |
| InChIKey | CSSALEYDOMGNND-UKBAYJJMSA-N |
| XLogP | 1.92 |
| TPSA | 83.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |