C20H29N5O2S — CID 176507035
2-[[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1,3-thiazole (PubChem CID 176507035) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is 2-[[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 176507035 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-[[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1,3-thiazole |
| SMILES | COCc1cn([C@@H]2C[C@@H]3CN(Cc4nccs4)C[C@@H]3C[C@H]2OCC2CC2)nn1 |
| InChI | InChI=1S/C20H29N5O2S/c1-26-13-17-10-25(23-22-17)18-6-15-8-24(11-20-21-4-5-28-20)9-16(15)7-19(18)27-12-14-2-3-14/h4-5,10,14-16,18-19H,2-3,6-9,11-13H2,1H3/t15-,16+,18-,19-/m1/s1 |
| InChIKey | CLIIATIBBRVWRA-UKBAYJJMSA-N |
| XLogP | 2.76 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |