C36H42N6O5S — CID 154813462
(9R,12S,16S,18S)-11-benzoyl-16-[(3-methoxyphenyl)methylamino]-4-methyl-3-thia-8,11,14,20,26-pentazapentacyclo[18.2.2.12,5.19,12.014,18]hexacosa-2(26),4-diene-7,13,19-trione (PubChem CID 154813462) has the molecular formula C36H42N6O5S and a molecular weight of 670.84 g/mol. Its IUPAC name is (9R,12S,16S,18S)-11-benzoyl-16-[(3-methoxyphenyl)methylamino]-4-methyl-3-thia-8,11,14,20,26-pentazapentacyclo[18.2.2.12,5.19,12.014,18]hexacosa-2(26),4-diene-7,13,19-trione.
| Compound Name | (9R,12S,16S,18S)-11-benzoyl-16-[(3-methoxyphenyl)methylamino]-4-methyl-3-thia-8,11,14,20,26-pentazapentacyclo[18.2.2.12,5.19,12.014,18]hexacosa-2(26),4-diene-7,13,19-trione |
|---|---|
| PubChem CID | 154813462 |
| Molecular Formula | C36H42N6O5S |
| Molecular Weight | 670.84 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | (9R,12S,16S,18S)-11-benzoyl-16-[(3-methoxyphenyl)methylamino]-4-methyl-3-thia-8,11,14,20,26-pentazapentacyclo[18.2.2.12,5.19,12.014,18]hexacosa-2(26),4-diene-7,13,19-trione |
| SMILES | COc1cccc(CN[C@H]2C[C@H]3C(=O)N4CCC(CC4)c4nc(c(C)s4)CC(=O)N[C@@H]4C[C@@H](C(=O)N3C2)N(C(=O)c2ccccc2)C4)c1 |
| InChI | InChI=1S/C36H42N6O5S/c1-22-29-18-32(43)38-27-17-31(41(21-27)34(44)25-8-4-3-5-9-25)36(46)42-20-26(37-19-23-7-6-10-28(15-23)47-2)16-30(42)35(45)40-13-11-24(12-14-40)33(39-29)48-22/h3-10,15,24,26-27,30-31,37H,11-14,16-21H2,1-2H3,(H,38,43)/t26-,27+,30-,31-/m0/s1 |
| InChIKey | VNBFRUCHEUQASV-JHYZPVKISA-N |
| XLogP | 2.88 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.84 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |