C38H47FN6O5S — CID 154813778
(15S)-8-[1-(4-fluorobenzoyl)piperidin-4-yl]-15-[(3-methoxyphenyl)methylamino]-4-methyl-3-thia-8,11,17,22-tetrazatricyclo[15.2.2.12,5]docosa-2(22),4-diene-7,10,16-trione (PubChem CID 154813778) has the molecular formula C38H47FN6O5S and a molecular weight of 718.90 g/mol. Its IUPAC name is (15S)-8-[1-(4-fluorobenzoyl)piperidin-4-yl]-15-[(3-methoxyphenyl)methylamino]-4-methyl-3-thia-8,11,17,22-tetrazatricyclo[15.2.2.12,5]docosa-2(22),4-diene-7,10,16-trione.
| Compound Name | (15S)-8-[1-(4-fluorobenzoyl)piperidin-4-yl]-15-[(3-methoxyphenyl)methylamino]-4-methyl-3-thia-8,11,17,22-tetrazatricyclo[15.2.2.12,5]docosa-2(22),4-diene-7,10,16-trione |
|---|---|
| PubChem CID | 154813778 |
| Molecular Formula | C38H47FN6O5S |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.33 |
| IUPAC Name | (15S)-8-[1-(4-fluorobenzoyl)piperidin-4-yl]-15-[(3-methoxyphenyl)methylamino]-4-methyl-3-thia-8,11,17,22-tetrazatricyclo[15.2.2.12,5]docosa-2(22),4-diene-7,10,16-trione |
| SMILES | COc1cccc(CN[C@H]2CCCNC(=O)CN(C3CCN(C(=O)c4ccc(F)cc4)CC3)C(=O)Cc3nc(sc3C)C3CCN(CC3)C2=O)c1 |
| InChI | InChI=1S/C38H47FN6O5S/c1-25-33-22-35(47)45(30-14-19-43(20-15-30)37(48)28-8-10-29(39)11-9-28)24-34(46)40-16-4-7-32(41-23-26-5-3-6-31(21-26)50-2)38(49)44-17-12-27(13-18-44)36(42-33)51-25/h3,5-6,8-11,21,27,30,32,41H,4,7,12-20,22-24H2,1-2H3,(H,40,46)/t32-/m0/s1 |
| InChIKey | NNXMEOZPRIVNNP-YTTGMZPUSA-N |
| XLogP | 4.05 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |