C26H27N3O4Si — CID 15481512
4-[[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]-dimethylsilyl]butanenitrile (PubChem CID 15481512) has the molecular formula C26H27N3O4Si and a molecular weight of 473.61 g/mol. Its IUPAC name is 4-[[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]-dimethylsilyl]butanenitrile.
| Compound Name | 4-[[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]-dimethylsilyl]butanenitrile |
|---|---|
| PubChem CID | 15481512 |
| Molecular Formula | C26H27N3O4Si |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 4-[[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]-dimethylsilyl]butanenitrile |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2[Si](C)(C)CCCC#N |
| InChI | InChI=1S/C26H27N3O4Si/c1-4-26(32)19-13-21-22-17(14-29(21)24(30)18(19)15-33-25(26)31)23(34(2,3)12-8-7-11-27)16-9-5-6-10-20(16)28-22/h5-6,9-10,13,32H,4,7-8,12,14-15H2,1-3H3/t26-/m0/s1 |
| InChIKey | ZEVMJAMYZNBJLT-SANMLTNESA-N |
| XLogP | 3.30 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|