C25H26N2O4Si — CID 70128903
(19S)-10-[dimethyl(prop-2-enyl)silyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 70128903) has the molecular formula C25H26N2O4Si and a molecular weight of 446.58 g/mol. Its IUPAC name is (19S)-10-[dimethyl(prop-2-enyl)silyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-10-[dimethyl(prop-2-enyl)silyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 70128903 |
| Molecular Formula | C25H26N2O4Si |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (19S)-10-[dimethyl(prop-2-enyl)silyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | C=CC[Si](C)(C)c1c2c(nc3ccccc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC |
| InChI | InChI=1S/C25H26N2O4Si/c1-5-11-32(3,4)22-15-9-7-8-10-19(15)26-21-16(22)13-27-20(21)12-18-17(23(27)28)14-31-24(29)25(18,30)6-2/h5,7-10,12,30H,1,6,11,13-14H2,2-4H3/t25-/m0/s1 |
| InChIKey | FMEGVHKWKNNNGB-VWLOTQADSA-N |
| XLogP | 3.18 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|