C16H21N3O3 — CID 154817273
(3S,4S)-4-[2-[2-(2-hydroxyethoxy)phenyl]imidazol-1-yl]piperidin-3-ol (PubChem CID 154817273) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is (3S,4S)-4-[2-[2-(2-hydroxyethoxy)phenyl]imidazol-1-yl]piperidin-3-ol.
| Compound Name | (3S,4S)-4-[2-[2-(2-hydroxyethoxy)phenyl]imidazol-1-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 154817273 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (3S,4S)-4-[2-[2-(2-hydroxyethoxy)phenyl]imidazol-1-yl]piperidin-3-ol |
| SMILES | OCCOc1ccccc1-c1nccn1[C@H]1CCNC[C@@H]1O |
| InChI | InChI=1S/C16H21N3O3/c20-9-10-22-15-4-2-1-3-12(15)16-18-7-8-19(16)13-5-6-17-11-14(13)21/h1-4,7-8,13-14,17,20-21H,5-6,9-11H2/t13-,14-/m0/s1 |
| InChIKey | BZAMAGHHHBKRMM-KBPBESRZSA-N |
| XLogP | 0.82 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |