C15H17F2N3 — CID 146044197
(3R,4S)-4-[2-(2,6-difluorophenyl)imidazol-1-yl]-3-methylpiperidine (PubChem CID 146044197) has the molecular formula C15H17F2N3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (3R,4S)-4-[2-(2,6-difluorophenyl)imidazol-1-yl]-3-methylpiperidine.
| Compound Name | (3R,4S)-4-[2-(2,6-difluorophenyl)imidazol-1-yl]-3-methylpiperidine |
|---|---|
| PubChem CID | 146044197 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (3R,4S)-4-[2-(2,6-difluorophenyl)imidazol-1-yl]-3-methylpiperidine |
| SMILES | C[C@@H]1CNCC[C@@H]1n1ccnc1-c1c(F)cccc1F |
| InChI | InChI=1S/C15H17F2N3/c1-10-9-18-6-5-13(10)20-8-7-19-15(20)14-11(16)3-2-4-12(14)17/h2-4,7-8,10,13,18H,5-6,9H2,1H3/t10-,13+/m1/s1 |
| InChIKey | VOBVNFBQQCALQJ-MFKMUULPSA-N |
| XLogP | 3.00 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |