C16H19FN2O4 — CID 163338029
formic acid;trans-(1S,2S)-2-[2-(2-fluoro-6-methoxyphenyl)imidazol-1-yl]cyclopentan-1-ol (PubChem CID 163338029) has the molecular formula C16H19FN2O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is formic acid;trans-(1S,2S)-2-[2-(2-fluoro-6-methoxyphenyl)imidazol-1-yl]cyclopentan-1-ol.
| Compound Name | formic acid;trans-(1S,2S)-2-[2-(2-fluoro-6-methoxyphenyl)imidazol-1-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 163338029 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | formic acid;trans-(1S,2S)-2-[2-(2-fluoro-6-methoxyphenyl)imidazol-1-yl]cyclopentan-1-ol |
| SMILES | COc1cccc(F)c1-c1nccn1[C@H]1CCC[C@@H]1O.O=CO |
| InChI | InChI=1S/C15H17FN2O2.CH2O2/c1-20-13-7-2-4-10(16)14(13)15-17-8-9-18(15)11-5-3-6-12(11)19;2-1-3/h2,4,7-9,11-12,19H,3,5-6H2,1H3;1H,(H,2,3)/t11-,12-;/m0./s1 |
| InChIKey | ZSDOEPWLOZNYLB-FXMYHANSSA-N |
| XLogP | 2.48 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|