C19H22FN5O3 — CID 154820646
N-[[(1S,5S,6R,7R)-3-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]furan-2-carboxamide (PubChem CID 154820646) has the molecular formula C19H22FN5O3 and a molecular weight of 387.42 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 154820646 |
| Molecular Formula | C19H22FN5O3 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]furan-2-carboxamide |
| SMILES | CNc1nc(N2C[C@@H]3[C@H](CNC(=O)c4ccco4)[C@H]4CC[C@]3(C2)O4)ncc1F |
| InChI | InChI=1S/C19H22FN5O3/c1-21-16-13(20)8-23-18(24-16)25-9-12-11(14-4-5-19(12,10-25)28-14)7-22-17(26)15-3-2-6-27-15/h2-3,6,8,11-12,14H,4-5,7,9-10H2,1H3,(H,22,26)(H,21,23,24)/t11-,12+,14+,19+/m0/s1 |
| InChIKey | KSQJZPMMNCTCLB-QULAYQROSA-N |
| XLogP | 1.66 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |