About 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene
1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene (PubChem CID 15482196) has the molecular formula C18H30
and a molecular weight of 246.44 g/mol. Its IUPAC name is 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene.
Analyze 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene?
The IUPAC name of 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene (CID 15482196) is 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene.
What is the SMILES notation for 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene?
The canonical SMILES for 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene is C=C1C(CCCC)=CC(CCCC)=C1CCCC.
What is the InChIKey of 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene?
The InChIKey is YLYXBEAKOLZHGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30/c1-5-8-11-16-14-17(12-9-6-2)18(15(16)4)13-10-7-3/h14H,4-13H2,1-3H3.
What are the key properties of 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene?
1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene has a molecular weight of 246.44 g/mol, XLogP of 6.35, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-tributyl-5-methylidenecyclopenta-1,3-diene is sourced from PubChem (CID 15482196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).