C15H19FN2O2 — CID 154822836
(4aR,6S,8aR)-N-(3-fluorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine-6-carboxamide (PubChem CID 154822836) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is (4aR,6S,8aR)-N-(3-fluorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aR,6S,8aR)-N-(3-fluorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 154822836 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (4aR,6S,8aR)-N-(3-fluorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine-6-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)[C@H]1CC[C@H]2OCCN[C@@H]2C1 |
| InChI | InChI=1S/C15H19FN2O2/c16-11-2-1-3-12(9-11)18-15(19)10-4-5-14-13(8-10)17-6-7-20-14/h1-3,9-10,13-14,17H,4-8H2,(H,18,19)/t10-,13+,14+/m0/s1 |
| InChIKey | JLEKSPPEBDUFQS-ZLKJLUDKSA-N |
| XLogP | 1.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |