C12H17NO5S — CID 15482470
N-(3,4-dimethoxyphenyl)-N-(3-oxopropyl)methanesulfonamide (PubChem CID 15482470) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-(3-oxopropyl)methanesulfonamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-(3-oxopropyl)methanesulfonamide |
|---|---|
| PubChem CID | 15482470 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-(3-oxopropyl)methanesulfonamide |
| SMILES | COc1ccc(N(CCC=O)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C12H17NO5S/c1-17-11-6-5-10(9-12(11)18-2)13(7-4-8-14)19(3,15)16/h5-6,8-9H,4,7H2,1-3H3 |
| InChIKey | AKMKNDDXBZIYMA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|