C19H26ClF3N6O4 — CID 154826231
5-[(2R)-1-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propan-2-yl]oxy-4-(trifluoromethyl)diazinan-3-one (PubChem CID 154826231) has the molecular formula C19H26ClF3N6O4 and a molecular weight of 494.90 g/mol. Its IUPAC name is 5-[(2R)-1-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propan-2-yl]oxy-4-(trifluoromethyl)diazinan-3-one.
| Compound Name | 5-[(2R)-1-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propan-2-yl]oxy-4-(trifluoromethyl)diazinan-3-one |
|---|---|
| PubChem CID | 154826231 |
| Molecular Formula | C19H26ClF3N6O4 |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 5-[(2R)-1-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propan-2-yl]oxy-4-(trifluoromethyl)diazinan-3-one |
| SMILES | C[C@H](COCCC(=O)N1CCN(c2ncc(Cl)cn2)CC1)OC1CNNC(=O)C1C(F)(F)F |
| InChI | InChI=1S/C19H26ClF3N6O4/c1-12(33-14-10-26-27-17(31)16(14)19(21,22)23)11-32-7-2-15(30)28-3-5-29(6-4-28)18-24-8-13(20)9-25-18/h8-9,12,14,16,26H,2-7,10-11H2,1H3,(H,27,31)/t12-,14?,16?/m1/s1 |
| InChIKey | FMTMOHKKNDNSLR-XEBKBJJBSA-N |
| XLogP | 0.77 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|