C19H21F3N6O4S — CID 154826451
2-[1-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-ylidene]amino]propoxy]propanoyl]pyrrolidin-3-yl]oxy-1,3-thiazole-5-carbonitrile (PubChem CID 154826451) has the molecular formula C19H21F3N6O4S and a molecular weight of 486.48 g/mol. Its IUPAC name is 2-[1-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-ylidene]amino]propoxy]propanoyl]pyrrolidin-3-yl]oxy-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[1-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-ylidene]amino]propoxy]propanoyl]pyrrolidin-3-yl]oxy-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 154826451 |
| Molecular Formula | C19H21F3N6O4S |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-[1-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-ylidene]amino]propoxy]propanoyl]pyrrolidin-3-yl]oxy-1,3-thiazole-5-carbonitrile |
| SMILES | C[C@@H](COCCC(=O)N1CCC(Oc2ncc(C#N)s2)C1)/N=C1\C=NNC(=O)C1C(F)(F)F |
| InChI | InChI=1S/C19H21F3N6O4S/c1-11(26-14-8-25-27-17(30)16(14)19(20,21)22)10-31-5-3-15(29)28-4-2-12(9-28)32-18-24-7-13(6-23)33-18/h7-8,11-12,16H,2-5,9-10H2,1H3,(H,27,30)/b26-14+/t11-,12?,16?/m0/s1 |
| InChIKey | SCCGAQOKOXWJST-DTIFELAUSA-N |
| XLogP | 1.52 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|