C23H19ClN4O3 — CID 154832712
4-[[2-[3-chloro-4-[(3-cyanophenyl)methoxy]anilino]-2-oxoethyl]amino]benzamide (PubChem CID 154832712) has the molecular formula C23H19ClN4O3 and a molecular weight of 434.88 g/mol. Its IUPAC name is 4-[[2-[3-chloro-4-[(3-cyanophenyl)methoxy]anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | 4-[[2-[3-chloro-4-[(3-cyanophenyl)methoxy]anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 154832712 |
| Molecular Formula | C23H19ClN4O3 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 4-[[2-[3-chloro-4-[(3-cyanophenyl)methoxy]anilino]-2-oxoethyl]amino]benzamide |
| SMILES | N#Cc1cccc(COc2ccc(NC(=O)CNc3ccc(C(N)=O)cc3)cc2Cl)c1 |
| InChI | InChI=1S/C23H19ClN4O3/c24-20-11-19(8-9-21(20)31-14-16-3-1-2-15(10-16)12-25)28-22(29)13-27-18-6-4-17(5-7-18)23(26)30/h1-11,27H,13-14H2,(H2,26,30)(H,28,29) |
| InChIKey | VMEDYDQBHCYRLX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 117.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |