C21H27NO6 — CID 154834372
[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] 3-(2-methoxy-2-oxoethoxy)benzoate (PubChem CID 154834372) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] 3-(2-methoxy-2-oxoethoxy)benzoate.
| Compound Name | [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] 3-(2-methoxy-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 154834372 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] 3-(2-methoxy-2-oxoethoxy)benzoate |
| SMILES | COC(=O)COc1cccc(C(=O)OCC(=O)NC(C)C2CC3CCC2C3)c1 |
| InChI | InChI=1S/C21H27NO6/c1-13(18-9-14-6-7-15(18)8-14)22-19(23)11-28-21(25)16-4-3-5-17(10-16)27-12-20(24)26-2/h3-5,10,13-15,18H,6-9,11-12H2,1-2H3,(H,22,23) |
| InChIKey | UDCSJZDKFSSQCV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |