C17H20Cl2N2O3 — CID 2342750
[2-[[(1S)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate (PubChem CID 2342750) has the molecular formula C17H20Cl2N2O3 and a molecular weight of 371.26 g/mol. Its IUPAC name is [2-[[(1S)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate.
| Compound Name | [2-[[(1S)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 2342750 |
| Molecular Formula | C17H20Cl2N2O3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | [2-[[(1S)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate |
| SMILES | C[C@H](NC(=O)COC(=O)c1cc(Cl)nc(Cl)c1)[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H20Cl2N2O3/c1-9(13-5-10-2-3-11(13)4-10)20-16(22)8-24-17(23)12-6-14(18)21-15(19)7-12/h6-7,9-11,13H,2-5,8H2,1H3,(H,20,22)/t9-,10+,11-,13+/m0/s1 |
| InChIKey | LLWIHCIMDFNYPA-SRRSOLGSSA-N |
| XLogP | 3.49 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|