C11H13F3N2O2S — CID 154834670
1-[1-[(sulfamoylamino)methyl]cyclopropyl]-3-(trifluoromethyl)benzene (PubChem CID 154834670) has the molecular formula C11H13F3N2O2S and a molecular weight of 294.30 g/mol. Its IUPAC name is 1-[1-[(sulfamoylamino)methyl]cyclopropyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[1-[(sulfamoylamino)methyl]cyclopropyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 154834670 |
| Molecular Formula | C11H13F3N2O2S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 1-[1-[(sulfamoylamino)methyl]cyclopropyl]-3-(trifluoromethyl)benzene |
| SMILES | NS(=O)(=O)NCC1(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C11H13F3N2O2S/c12-11(13,14)9-3-1-2-8(6-9)10(4-5-10)7-16-19(15,17)18/h1-3,6,16H,4-5,7H2,(H2,15,17,18) |
| InChIKey | QHDMIYOOXUKRLT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |