C16H16FN3O2 — CID 154836655
2-cyclopropyl-N-[(2-fluorophenyl)methyl]-N-methyl-6-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 154836655) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(2-fluorophenyl)methyl]-N-methyl-6-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-[(2-fluorophenyl)methyl]-N-methyl-6-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 154836655 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-cyclopropyl-N-[(2-fluorophenyl)methyl]-N-methyl-6-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | CN(Cc1ccccc1F)C(=O)c1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C16H16FN3O2/c1-20(9-11-4-2-3-5-12(11)17)16(22)13-8-14(21)19-15(18-13)10-6-7-10/h2-5,8,10H,6-7,9H2,1H3,(H,18,19,21) |
| InChIKey | QMZZILSFCFSPGN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |