C21H18N4O3 — CID 154837172
1,3-dioxo-N-[2-(2-phenylethynyl)phenyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide (PubChem CID 154837172) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1,3-dioxo-N-[2-(2-phenylethynyl)phenyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide.
| Compound Name | 1,3-dioxo-N-[2-(2-phenylethynyl)phenyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 154837172 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1,3-dioxo-N-[2-(2-phenylethynyl)phenyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide |
| SMILES | O=C1NC(=O)N2CCN(C(=O)Nc3ccccc3C#Cc3ccccc3)CC12 |
| InChI | InChI=1S/C21H18N4O3/c26-19-18-14-24(12-13-25(18)21(28)23-19)20(27)22-17-9-5-4-8-16(17)11-10-15-6-2-1-3-7-15/h1-9,18H,12-14H2,(H,22,27)(H,23,26,28) |
| InChIKey | MIXKPVCOZZJWSC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|