C16H20N2O2 — CID 79163125
N-[2-(3-hydroxyprop-1-ynyl)phenyl]-3-methylpiperidine-1-carboxamide (PubChem CID 79163125) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[2-(3-hydroxyprop-1-ynyl)phenyl]-3-methylpiperidine-1-carboxamide.
| Compound Name | N-[2-(3-hydroxyprop-1-ynyl)phenyl]-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 79163125 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[2-(3-hydroxyprop-1-ynyl)phenyl]-3-methylpiperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)Nc2ccccc2C#CCO)C1 |
| InChI | InChI=1S/C16H20N2O2/c1-13-6-4-10-18(12-13)16(20)17-15-9-3-2-7-14(15)8-5-11-19/h2-3,7,9,13,19H,4,6,10-12H2,1H3,(H,17,20) |
| InChIKey | QUHJSKXNRGEYJN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|