C16H18F3N5O2 — CID 154838768
2,2-dimethyl-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-3,5-dihydro-1,4-benzoxazepine-4-carboxamide (PubChem CID 154838768) has the molecular formula C16H18F3N5O2 and a molecular weight of 369.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-3,5-dihydro-1,4-benzoxazepine-4-carboxamide.
| Compound Name | 2,2-dimethyl-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-3,5-dihydro-1,4-benzoxazepine-4-carboxamide |
|---|---|
| PubChem CID | 154838768 |
| Molecular Formula | C16H18F3N5O2 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2,2-dimethyl-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-3,5-dihydro-1,4-benzoxazepine-4-carboxamide |
| SMILES | CC1(C)CN(C(=O)NCc2nc(C(F)(F)F)n[nH]2)Cc2ccccc2O1 |
| InChI | InChI=1S/C16H18F3N5O2/c1-15(2)9-24(8-10-5-3-4-6-11(10)26-15)14(25)20-7-12-21-13(23-22-12)16(17,18)19/h3-6H,7-9H2,1-2H3,(H,20,25)(H,21,22,23) |
| InChIKey | JQLFSIBZSWZVJF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |