C12H12F3N7O2 — CID 166224021
3-oxo-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-2,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6-carboxamide (PubChem CID 166224021) has the molecular formula C12H12F3N7O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 3-oxo-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-2,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6-carboxamide.
| Compound Name | 3-oxo-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-2,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 166224021 |
| Molecular Formula | C12H12F3N7O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-oxo-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-2,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6-carboxamide |
| SMILES | O=C(NCc1nc(C(F)(F)F)n[nH]1)N1CCc2n[nH]c(=O)cc2C1 |
| InChI | InChI=1S/C12H12F3N7O2/c13-12(14,15)10-17-8(19-21-10)4-16-11(24)22-2-1-7-6(5-22)3-9(23)20-18-7/h3H,1-2,4-5H2,(H,16,24)(H,20,23)(H,17,19,21) |
| InChIKey | BLGGGTXMFAVPBN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |