C14H15NO6S — CID 154839721
3-(furan-2-ylsulfonylamino)-3-(4-methoxyphenyl)propanoic acid (PubChem CID 154839721) has the molecular formula C14H15NO6S and a molecular weight of 325.34 g/mol. Its IUPAC name is 3-(furan-2-ylsulfonylamino)-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | 3-(furan-2-ylsulfonylamino)-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 154839721 |
| Molecular Formula | C14H15NO6S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-(furan-2-ylsulfonylamino)-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)NS(=O)(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C14H15NO6S/c1-20-11-6-4-10(5-7-11)12(9-13(16)17)15-22(18,19)14-3-2-8-21-14/h2-8,12,15H,9H2,1H3,(H,16,17) |
| InChIKey | PDMAFPJOPLCDOY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |