C18H23N3O2 — CID 154841992
N-(azepan-4-yl)-N,5-dimethyl-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 154841992) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(azepan-4-yl)-N,5-dimethyl-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(azepan-4-yl)-N,5-dimethyl-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 154841992 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-(azepan-4-yl)-N,5-dimethyl-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)N(C)C1CCCNCC1 |
| InChI | InChI=1S/C18H23N3O2/c1-13-16(17(20-23-13)14-7-4-3-5-8-14)18(22)21(2)15-9-6-11-19-12-10-15/h3-5,7-8,15,19H,6,9-12H2,1-2H3 |
| InChIKey | ZLOLDQWAELUUHU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |