C17H20N4O4 — CID 154843375
N-(2-ethoxy-4-hydroxyphenyl)-6-morpholin-4-ylpyrimidine-4-carboxamide (PubChem CID 154843375) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-(2-ethoxy-4-hydroxyphenyl)-6-morpholin-4-ylpyrimidine-4-carboxamide.
| Compound Name | N-(2-ethoxy-4-hydroxyphenyl)-6-morpholin-4-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 154843375 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(2-ethoxy-4-hydroxyphenyl)-6-morpholin-4-ylpyrimidine-4-carboxamide |
| SMILES | CCOc1cc(O)ccc1NC(=O)c1cc(N2CCOCC2)ncn1 |
| InChI | InChI=1S/C17H20N4O4/c1-2-25-15-9-12(22)3-4-13(15)20-17(23)14-10-16(19-11-18-14)21-5-7-24-8-6-21/h3-4,9-11,22H,2,5-8H2,1H3,(H,20,23) |
| InChIKey | UQMTUSKTCXURTL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|