C20H22N2O3 — CID 154845862
5-[2-(5-methylfuran-2-yl)azepane-1-carbonyl]-2,3-dihydroisoindol-1-one (PubChem CID 154845862) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 5-[2-(5-methylfuran-2-yl)azepane-1-carbonyl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[2-(5-methylfuran-2-yl)azepane-1-carbonyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 154845862 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 5-[2-(5-methylfuran-2-yl)azepane-1-carbonyl]-2,3-dihydroisoindol-1-one |
| SMILES | Cc1ccc(C2CCCCCN2C(=O)c2ccc3c(c2)CNC3=O)o1 |
| InChI | InChI=1S/C20H22N2O3/c1-13-6-9-18(25-13)17-5-3-2-4-10-22(17)20(24)14-7-8-16-15(11-14)12-21-19(16)23/h6-9,11,17H,2-5,10,12H2,1H3,(H,21,23) |
| InChIKey | DTGMRENNEWGJBL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |