C16H23NO5S — CID 154846581
3-methoxy-2-(3-oxa-9-azaspiro[5.5]undecan-9-ylsulfonyl)phenol (PubChem CID 154846581) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 3-methoxy-2-(3-oxa-9-azaspiro[5.5]undecan-9-ylsulfonyl)phenol.
| Compound Name | 3-methoxy-2-(3-oxa-9-azaspiro[5.5]undecan-9-ylsulfonyl)phenol |
|---|---|
| PubChem CID | 154846581 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-methoxy-2-(3-oxa-9-azaspiro[5.5]undecan-9-ylsulfonyl)phenol |
| SMILES | COc1cccc(O)c1S(=O)(=O)N1CCC2(CCOCC2)CC1 |
| InChI | InChI=1S/C16H23NO5S/c1-21-14-4-2-3-13(18)15(14)23(19,20)17-9-5-16(6-10-17)7-11-22-12-8-16/h2-4,18H,5-12H2,1H3 |
| InChIKey | IQYAVERKKJYSLN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |