C16H13ClN4O3S2 — CID 154848341
4-chloro-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]thiophene-3-carboxamide (PubChem CID 154848341) has the molecular formula C16H13ClN4O3S2 and a molecular weight of 408.89 g/mol. Its IUPAC name is 4-chloro-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]thiophene-3-carboxamide.
| Compound Name | 4-chloro-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 154848341 |
| Molecular Formula | C16H13ClN4O3S2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 4-chloro-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]thiophene-3-carboxamide |
| SMILES | Cc1ccnc(NS(=O)(=O)c2ccc(NC(=O)c3cscc3Cl)cc2)n1 |
| InChI | InChI=1S/C16H13ClN4O3S2/c1-10-6-7-18-16(19-10)21-26(23,24)12-4-2-11(3-5-12)20-15(22)13-8-25-9-14(13)17/h2-9H,1H3,(H,20,22)(H,18,19,21) |
| InChIKey | JPUPFUNHDHEIPW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |