C17H16F2N2O — CID 154848463
4-[(2,6-difluorophenyl)methylamino]-3-propan-2-yloxybenzonitrile (PubChem CID 154848463) has the molecular formula C17H16F2N2O and a molecular weight of 302.32 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)methylamino]-3-propan-2-yloxybenzonitrile.
| Compound Name | 4-[(2,6-difluorophenyl)methylamino]-3-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 154848463 |
| Molecular Formula | C17H16F2N2O |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-[(2,6-difluorophenyl)methylamino]-3-propan-2-yloxybenzonitrile |
| SMILES | CC(C)Oc1cc(C#N)ccc1NCc1c(F)cccc1F |
| InChI | InChI=1S/C17H16F2N2O/c1-11(2)22-17-8-12(9-20)6-7-16(17)21-10-13-14(18)4-3-5-15(13)19/h3-8,11,21H,10H2,1-2H3 |
| InChIKey | YXRMUTCVZLTNPH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |