C22H20N4O3 — CID 154850128
2-[(6-oxo-3-phenylpiperidine-3-carbonyl)amino]quinoline-4-carboxamide (PubChem CID 154850128) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[(6-oxo-3-phenylpiperidine-3-carbonyl)amino]quinoline-4-carboxamide.
| Compound Name | 2-[(6-oxo-3-phenylpiperidine-3-carbonyl)amino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 154850128 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[(6-oxo-3-phenylpiperidine-3-carbonyl)amino]quinoline-4-carboxamide |
| SMILES | NC(=O)c1cc(NC(=O)C2(c3ccccc3)CCC(=O)NC2)nc2ccccc12 |
| InChI | InChI=1S/C22H20N4O3/c23-20(28)16-12-18(25-17-9-5-4-8-15(16)17)26-21(29)22(11-10-19(27)24-13-22)14-6-2-1-3-7-14/h1-9,12H,10-11,13H2,(H2,23,28)(H,24,27)(H,25,26,29) |
| InChIKey | NBLLHDCKNGOSQP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |