C15H11F2N3O2 — CID 154850422
2-[6-(difluoromethoxy)-2-pyridinyl]-6-methyl-3H-quinazolin-4-one (PubChem CID 154850422) has the molecular formula C15H11F2N3O2 and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-[6-(difluoromethoxy)-2-pyridinyl]-6-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[6-(difluoromethoxy)-2-pyridinyl]-6-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 154850422 |
| Molecular Formula | C15H11F2N3O2 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-[6-(difluoromethoxy)-2-pyridinyl]-6-methyl-3H-quinazolin-4-one |
| SMILES | Cc1ccc2nc(-c3cccc(OC(F)F)n3)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C15H11F2N3O2/c1-8-5-6-10-9(7-8)14(21)20-13(19-10)11-3-2-4-12(18-11)22-15(16)17/h2-7,15H,1H3,(H,19,20,21) |
| InChIKey | NBVNQDIODCMAIQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |