C26H18N4O4 — CID 154851202
2,4-dioxo-3-phenyl-N-(3-pyridin-4-yloxyphenyl)-1H-quinazoline-7-carboxamide (PubChem CID 154851202) has the molecular formula C26H18N4O4 and a molecular weight of 450.45 g/mol. Its IUPAC name is 2,4-dioxo-3-phenyl-N-(3-pyridin-4-yloxyphenyl)-1H-quinazoline-7-carboxamide.
| Compound Name | 2,4-dioxo-3-phenyl-N-(3-pyridin-4-yloxyphenyl)-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 154851202 |
| Molecular Formula | C26H18N4O4 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2,4-dioxo-3-phenyl-N-(3-pyridin-4-yloxyphenyl)-1H-quinazoline-7-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2ccncc2)c1)c1ccc2c(=O)n(-c3ccccc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C26H18N4O4/c31-24(28-18-5-4-8-21(16-18)34-20-11-13-27-14-12-20)17-9-10-22-23(15-17)29-26(33)30(25(22)32)19-6-2-1-3-7-19/h1-16H,(H,28,31)(H,29,33) |
| InChIKey | RLNJDDTVRPJIAV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |