About N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide
N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide (PubChem CID 154851586) has the molecular formula C22H22N2O
and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide.
Molecular Properties
| Compound Name | N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide |
| PubChem CID | 154851586 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide |
| SMILES | Cc1cc(C)cc(C(C)NC(=O)c2ccccc2-c2ccncc2)c1 |
| InChI | InChI=1S/C22H22N2O/c1-15-12-16(2)14-19(13-15)17(3)24-22(25)21-7-5-4-6-20(21)18-8-10-23-11-9-18/h4-14,17H,1-3H3,(H,24,25) |
| InChIKey | FSQJZJYWCBLFRL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide?
The IUPAC name of N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide (CID 154851586) is N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide.
What is the SMILES notation for N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide?
The canonical SMILES for N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide is Cc1cc(C)cc(C(C)NC(=O)c2ccccc2-c2ccncc2)c1.
What is the InChIKey of N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide?
The InChIKey is FSQJZJYWCBLFRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O/c1-15-12-16(2)14-19(13-15)17(3)24-22(25)21-7-5-4-6-20(21)18-8-10-23-11-9-18/h4-14,17H,1-3H3,(H,24,25).
What are the key properties of N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide?
N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide has a molecular weight of 330.43 g/mol, XLogP of 4.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,5-dimethylphenyl)ethyl]-2-pyridin-4-ylbenzamide is sourced from PubChem (CID 154851586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).