C24H26FN5O3 — CID 154852218
ethyl 3-[3-[[(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)carbamoylamino]methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate (PubChem CID 154852218) has the molecular formula C24H26FN5O3 and a molecular weight of 451.50 g/mol. Its IUPAC name is ethyl 3-[3-[[(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)carbamoylamino]methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-[3-[[(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)carbamoylamino]methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 154852218 |
| Molecular Formula | C24H26FN5O3 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | ethyl 3-[3-[[(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)carbamoylamino]methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cccc(CNC(=O)NC3c4cccc(F)c4CCC3C)c2)n[nH]1 |
| InChI | InChI=1S/C24H26FN5O3/c1-3-33-23(31)22-28-21(29-30-22)16-7-4-6-15(12-16)13-26-24(32)27-20-14(2)10-11-17-18(20)8-5-9-19(17)25/h4-9,12,14,20H,3,10-11,13H2,1-2H3,(H2,26,27,32)(H,28,29,30) |
| InChIKey | OAJDKTMTMZBPBY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |