C14H7Cl2FN2OS — CID 154852347
N-(3,5-dichloro-2-fluorophenyl)-1,3-benzothiazole-4-carboxamide (PubChem CID 154852347) has the molecular formula C14H7Cl2FN2OS and a molecular weight of 341.19 g/mol. Its IUPAC name is N-(3,5-dichloro-2-fluorophenyl)-1,3-benzothiazole-4-carboxamide.
| Compound Name | N-(3,5-dichloro-2-fluorophenyl)-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 154852347 |
| Molecular Formula | C14H7Cl2FN2OS |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | N-(3,5-dichloro-2-fluorophenyl)-1,3-benzothiazole-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1F)c1cccc2scnc12 |
| InChI | InChI=1S/C14H7Cl2FN2OS/c15-7-4-9(16)12(17)10(5-7)19-14(20)8-2-1-3-11-13(8)18-6-21-11/h1-6H,(H,19,20) |
| InChIKey | WGPHVOGELFINAZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|