C17H19BrN4O2S — CID 154852433
2-[[1-(4-bromophenyl)cyclohexyl]carbamoylamino]-1,3-thiazole-5-carboxamide (PubChem CID 154852433) has the molecular formula C17H19BrN4O2S and a molecular weight of 423.34 g/mol. Its IUPAC name is 2-[[1-(4-bromophenyl)cyclohexyl]carbamoylamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[1-(4-bromophenyl)cyclohexyl]carbamoylamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 154852433 |
| Molecular Formula | C17H19BrN4O2S |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 2-[[1-(4-bromophenyl)cyclohexyl]carbamoylamino]-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cnc(NC(=O)NC2(c3ccc(Br)cc3)CCCCC2)s1 |
| InChI | InChI=1S/C17H19BrN4O2S/c18-12-6-4-11(5-7-12)17(8-2-1-3-9-17)22-15(24)21-16-20-10-13(25-16)14(19)23/h4-7,10H,1-3,8-9H2,(H2,19,23)(H2,20,21,22,24) |
| InChIKey | ZAJMGDSUEWWIOQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |