C25H28N3O5PS — CID 154853355
3-[3-[3-[(4-oxo-2,6-diphenyl-1,4λ5-oxaphosphinin-4-yl)amino]propyl]imidazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 154853355) has the molecular formula C25H28N3O5PS and a molecular weight of 513.56 g/mol. Its IUPAC name is 3-[3-[3-[(4-oxo-2,6-diphenyl-1,4λ5-oxaphosphinin-4-yl)amino]propyl]imidazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[3-[3-[(4-oxo-2,6-diphenyl-1,4λ5-oxaphosphinin-4-yl)amino]propyl]imidazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 154853355 |
| Molecular Formula | C25H28N3O5PS |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 3-[3-[3-[(4-oxo-2,6-diphenyl-1,4λ5-oxaphosphinin-4-yl)amino]propyl]imidazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | O=P1(NCCCn2cc[n+](CCCS(=O)(=O)[O-])c2)C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C25H28N3O5PS/c29-34(26-13-7-14-27-16-17-28(21-27)15-8-18-35(30,31)32)19-24(22-9-3-1-4-10-22)33-25(20-34)23-11-5-2-6-12-23/h1-6,9-12,16-17,19-21H,7-8,13-15,18H2,(H-,26,29,30,31,32) |
| InChIKey | PJGVLAGHBBPPKS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|